C35H52O4SSi3 — CID 11204548
tert-butyl-diphenyl-[(2R,3S)-4-[(2R,3S)-3-(phenylsulfanylmethyl)oxiran-2-yl]-2,3-bis(trimethylsilyloxy)butoxy]silane (PubChem CID 11204548) has the molecular formula C35H52O4SSi3 and a molecular weight of 653.12 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2R,3S)-4-[(2R,3S)-3-(phenylsulfanylmethyl)oxiran-2-yl]-2,3-bis(trimethylsilyloxy)butoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2R,3S)-4-[(2R,3S)-3-(phenylsulfanylmethyl)oxiran-2-yl]-2,3-bis(trimethylsilyloxy)butoxy]silane |
|---|---|
| PubChem CID | 11204548 |
| Molecular Formula | C35H52O4SSi3 |
| Molecular Weight | 653.12 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | tert-butyl-diphenyl-[(2R,3S)-4-[(2R,3S)-3-(phenylsulfanylmethyl)oxiran-2-yl]-2,3-bis(trimethylsilyloxy)butoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@@H](O[Si](C)(C)C)[C@H](C[C@H]1O[C@@H]1CSc1ccccc1)O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H52O4SSi3/c1-35(2,3)43(29-21-15-11-16-22-29,30-23-17-12-18-24-30)36-26-33(39-42(7,8)9)32(38-41(4,5)6)25-31-34(37-31)27-40-28-19-13-10-14-20-28/h10-24,31-34H,25-27H2,1-9H3/t31-,32+,33-,34-/m1/s1 |
| InChIKey | FAUFEAUGOQQLCM-KMKAFXEASA-N |
| XLogP | 7.95 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.12 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|