C22H39N5O3 — CID 11204996
N-[(1R)-2-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-(4-hydroxyphenyl)-2-oxoethyl]butanamide (PubChem CID 11204996) has the molecular formula C22H39N5O3 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[(1R)-2-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-(4-hydroxyphenyl)-2-oxoethyl]butanamide.
| Compound Name | N-[(1R)-2-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-(4-hydroxyphenyl)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 11204996 |
| Molecular Formula | C22H39N5O3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | N-[(1R)-2-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-(4-hydroxyphenyl)-2-oxoethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](C(=O)NCCCNCCCCNCCCN)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H39N5O3/c1-2-7-20(29)27-21(18-8-10-19(28)11-9-18)22(30)26-17-6-16-25-14-4-3-13-24-15-5-12-23/h8-11,21,24-25,28H,2-7,12-17,23H2,1H3,(H,26,30)(H,27,29)/t21-/m1/s1 |
| InChIKey | IQSNWZCDUQHKCA-OAQYLSRUSA-N |
| XLogP | 1.16 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|