C16H26O6Si — CID 11210062
dimethyl (3Z)-3-[[diethoxy(methyl)silyl]methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 11210062) has the molecular formula C16H26O6Si and a molecular weight of 342.46 g/mol. Its IUPAC name is dimethyl (3Z)-3-[[diethoxy(methyl)silyl]methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z)-3-[[diethoxy(methyl)silyl]methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11210062 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | dimethyl (3Z)-3-[[diethoxy(methyl)silyl]methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C/C1=C/[Si](C)(OCC)OCC |
| InChI | InChI=1S/C16H26O6Si/c1-7-21-23(6,22-8-2)11-13-10-16(9-12(13)3,14(17)19-4)15(18)20-5/h11H,3,7-10H2,1-2,4-6H3/b13-11- |
| InChIKey | XJSHQINPLQNALW-QBFSEMIESA-N |
| XLogP | 2.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|