C17H26N2O2SSi — CID 11210300
4-methyl-N-[(1S,4S)-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl]benzenesulfonamide (PubChem CID 11210300) has the molecular formula C17H26N2O2SSi and a molecular weight of 350.56 g/mol. Its IUPAC name is 4-methyl-N-[(1S,4S)-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,4S)-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11210300 |
| Molecular Formula | C17H26N2O2SSi |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-methyl-N-[(1S,4S)-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl]benzenesulfonamide |
| SMILES | C=C1C[C@@H]2CC[C@@]1([Si](C)(C)C)N2NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H26N2O2SSi/c1-13-6-8-16(9-7-13)22(20,21)18-19-15-10-11-17(19,14(2)12-15)23(3,4)5/h6-9,15,18H,2,10-12H2,1,3-5H3/t15-,17-/m0/s1 |
| InChIKey | SUWMNDLTSTVJEU-RDJZCZTQSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|