C26H28N4O4S2 — CID 134983474
4-methyl-N-[(2Z,9Z)-13-[(4-methylphenyl)sulfonylamino]-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-6-yl]benzenesulfonamide (PubChem CID 134983474) has the molecular formula C26H28N4O4S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 4-methyl-N-[(2Z,9Z)-13-[(4-methylphenyl)sulfonylamino]-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-6-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2Z,9Z)-13-[(4-methylphenyl)sulfonylamino]-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134983474 |
| Molecular Formula | C26H28N4O4S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4-methyl-N-[(2Z,9Z)-13-[(4-methylphenyl)sulfonylamino]-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-6-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN2CC3=C(/C=C\C4=C(/C=C\3)CN(NS(=O)(=O)c3ccc(C)cc3)C4)C2)cc1 |
| InChI | InChI=1S/C26H28N4O4S2/c1-19-3-11-25(12-4-19)35(31,32)27-29-15-21-7-9-23-17-30(18-24(23)10-8-22(21)16-29)28-36(33,34)26-13-5-20(2)6-14-26/h3-14,27-28H,15-18H2,1-2H3/b9-7-,10-8-,21-7-,22-8-,23-9-,24-10- |
| InChIKey | OCXPGVCXRSCBGO-IMSXYYSFSA-N |
| XLogP | 2.74 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |