C19H26N2O2S — CID 98163683
N-[(1R,6R)-12-azatricyclo[4.4.3.01,6]tridec-2-en-12-yl]-4-methylbenzenesulfonamide (PubChem CID 98163683) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[(1R,6R)-12-azatricyclo[4.4.3.01,6]tridec-2-en-12-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,6R)-12-azatricyclo[4.4.3.01,6]tridec-2-en-12-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98163683 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[(1R,6R)-12-azatricyclo[4.4.3.01,6]tridec-2-en-12-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN2C[C@]34C=CCC[C@@]3(CCCC4)C2)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-16-6-8-17(9-7-16)24(22,23)20-21-14-18-10-2-3-11-19(18,15-21)13-5-4-12-18/h2,6-10,20H,3-5,11-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | KWPKBXJUTHADDU-RTBURBONSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|