C18H28N2O2SSi — CID 5242559
4-methyl-N-(4-methyl-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl)benzenesulfonamide (PubChem CID 5242559) has the molecular formula C18H28N2O2SSi and a molecular weight of 364.59 g/mol. Its IUPAC name is 4-methyl-N-(4-methyl-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(4-methyl-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5242559 |
| Molecular Formula | C18H28N2O2SSi |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-methyl-N-(4-methyl-2-methylidene-1-trimethylsilyl-7-azabicyclo[2.2.1]heptan-7-yl)benzenesulfonamide |
| SMILES | C=C1CC2(C)CCC1([Si](C)(C)C)N2NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H28N2O2SSi/c1-14-7-9-16(10-8-14)23(21,22)19-20-17(3)11-12-18(20,15(2)13-17)24(4,5)6/h7-10,19H,2,11-13H2,1,3-6H3 |
| InChIKey | ATIVNYOPDFPHFL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|