C21H29N3O7P+ — CID 11213475
2-[[(4aR,6R,7aR)-2-oxo-6-(2-oxopyrimidin-1-yl)-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl-trimethylazanium (PubChem CID 11213475) has the molecular formula C21H29N3O7P+ and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-[[(4aR,6R,7aR)-2-oxo-6-(2-oxopyrimidin-1-yl)-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl-trimethylazanium.
| Compound Name | 2-[[(4aR,6R,7aR)-2-oxo-6-(2-oxopyrimidin-1-yl)-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 11213475 |
| Molecular Formula | C21H29N3O7P+ |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[[(4aR,6R,7aR)-2-oxo-6-(2-oxopyrimidin-1-yl)-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP1(=O)OC[C@H]2O[C@@H](n3cccnc3=O)C(OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C21H29N3O7P/c1-24(2,3)12-13-28-32(26)29-15-17-18(31-32)19(27-14-16-8-5-4-6-9-16)20(30-17)23-11-7-10-22-21(23)25/h4-11,17-20H,12-15H2,1-3H3/q+1/t17-,18-,19?,20-,32?/m1/s1 |
| InChIKey | HUAWRTUYNLEZDE-RSYWONSYSA-N |
| XLogP | 1.97 |
| TPSA | 98.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|