C78H90CuN6 — CID 11217073
copper 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,12-dicarbonitrile (PubChem CID 11217073) has the molecular formula C78H90CuN6 and a molecular weight of 1175.17 g/mol. Its IUPAC name is copper 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,12-dicarbonitrile.
| Compound Name | copper 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,12-dicarbonitrile |
|---|---|
| PubChem CID | 11217073 |
| Molecular Formula | C78H90CuN6 |
| Molecular Weight | 1175.17 g/mol |
| Exact Mass | 1173.65 |
| IUPAC Name | copper 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,12-dicarbonitrile |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([n-]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[n-]5)C(C#N)=C4)C(C#N)=C3)cc(C(C)(C)C)c1.[Cu+2] |
| InChI | InChI=1S/C78H90N6.Cu/c1-71(2,3)51-29-45(30-52(39-51)72(4,5)6)65-59-25-27-61(81-59)67(47-33-55(75(13,14)15)41-56(34-47)76(16,17)18)70-50(44-80)38-64(84-70)66(46-31-53(73(7,8)9)40-54(32-46)74(10,11)12)60-26-28-62(82-60)68(69-49(43-79)37-63(65)83-69)48-35-57(77(19,20)21)42-58(36-48)78(22,23)24;/h25-42H,1-24H3;/q-2;+2/b65-59-,65-63-,66-60-,66-64-,67-61-,68-62-,69-68-,70-67-; |
| InChIKey | CCOBGALIQQUTIR-ITISJHFLSA-N |
| XLogP | 20.75 |
| TPSA | 101.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.17 |
| LogP ≤ 5 | 20.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |