C26H40O5 — CID 11224251
ethyl (1R,4E,10E,12R,16S,17R)-1,4,8,14,14-pentamethyl-9-oxo-17-propan-2-yl-13,15-dioxatricyclo[9.6.0.012,16]heptadeca-4,10-diene-6-carboxylate (PubChem CID 11224251) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is ethyl (1R,4E,10E,12R,16S,17R)-1,4,8,14,14-pentamethyl-9-oxo-17-propan-2-yl-13,15-dioxatricyclo[9.6.0.012,16]heptadeca-4,10-diene-6-carboxylate.
| Compound Name | ethyl (1R,4E,10E,12R,16S,17R)-1,4,8,14,14-pentamethyl-9-oxo-17-propan-2-yl-13,15-dioxatricyclo[9.6.0.012,16]heptadeca-4,10-diene-6-carboxylate |
|---|---|
| PubChem CID | 11224251 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | ethyl (1R,4E,10E,12R,16S,17R)-1,4,8,14,14-pentamethyl-9-oxo-17-propan-2-yl-13,15-dioxatricyclo[9.6.0.012,16]heptadeca-4,10-diene-6-carboxylate |
| SMILES | CCOC(=O)C1/C=C(\C)CC[C@@]2(C)/C(=C\C(=O)C(C)C1)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C26H40O5/c1-9-29-24(28)18-12-16(4)10-11-26(8)19(14-20(27)17(5)13-18)22-23(21(26)15(2)3)31-25(6,7)30-22/h12,14-15,17-18,21-23H,9-11,13H2,1-8H3/b16-12+,19-14-/t17?,18?,21-,22+,23-,26-/m0/s1 |
| InChIKey | CMHXASDBZPHLQJ-ZLMGELNMSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|