C25H38O6 — CID 11611811
ethyl 5-[(3aR,6R,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopentanoate (PubChem CID 11611811) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is ethyl 5-[(3aR,6R,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopentanoate.
| Compound Name | ethyl 5-[(3aR,6R,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 11611811 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | ethyl 5-[(3aR,6R,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopentanoate |
| SMILES | CCOC(=O)CC(=O)CC[C@@]1(C)CC[C@@]2(C)C(=CC1=O)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C25H38O6/c1-8-29-19(28)13-16(26)9-10-24(6)11-12-25(7)17(14-18(24)27)21-22(20(25)15(2)3)31-23(4,5)30-21/h14-15,20-22H,8-13H2,1-7H3/t20-,21+,22-,24-,25-/m0/s1 |
| InChIKey | SZHRUNJESMPUCS-ANRPBIDPSA-N |
| XLogP | 4.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|