C21H32O5 — CID 11462669
ethyl (3aR,6S,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate (PubChem CID 11462669) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is ethyl (3aR,6S,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate.
| Compound Name | ethyl (3aR,6S,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 11462669 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl (3aR,6S,8aR,9R,9aS)-2,2,6,8a-tetramethyl-5-oxo-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)CC[C@@]2(C)C(=CC1=O)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C21H32O5/c1-8-24-18(23)21(7)10-9-20(6)13(11-14(21)22)16-17(15(20)12(2)3)26-19(4,5)25-16/h11-12,15-17H,8-10H2,1-7H3/t15-,16+,17-,20-,21-/m0/s1 |
| InChIKey | RFPNUVYYFQFDQI-ZCZMFWIKSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|