C25H36O5 — CID 11575273
ethyl (8R,11R,12R,13S,17R)-8,11,15,15-tetramethyl-5-oxo-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,3-diene-4-carboxylate (PubChem CID 11575273) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is ethyl (8R,11R,12R,13S,17R)-8,11,15,15-tetramethyl-5-oxo-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,3-diene-4-carboxylate.
| Compound Name | ethyl (8R,11R,12R,13S,17R)-8,11,15,15-tetramethyl-5-oxo-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,3-diene-4-carboxylate |
|---|---|
| PubChem CID | 11575273 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethyl (8R,11R,12R,13S,17R)-8,11,15,15-tetramethyl-5-oxo-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,3-diene-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C=C3[C@H]4OC(C)(C)O[C@H]4[C@H](C(C)C)[C@@]3(C)CC[C@]2(C)CCC1=O |
| InChI | InChI=1S/C25H36O5/c1-8-28-22(27)18-15-13-16-20-21(30-23(4,5)29-20)19(14(2)3)25(16,7)12-11-24(15,6)10-9-17(18)26/h13-14,19-21H,8-12H2,1-7H3/t19-,20+,21-,24-,25-/m0/s1 |
| InChIKey | OIEJCESEZYPOGL-KOSDUOMESA-N |
| XLogP | 4.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|