C18H15ClN4O2 — CID 11233552
[(1S,4R)-4-(6-chloropurin-9-yl)-4-methylcyclopent-2-en-1-yl] benzoate (PubChem CID 11233552) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is [(1S,4R)-4-(6-chloropurin-9-yl)-4-methylcyclopent-2-en-1-yl] benzoate.
| Compound Name | [(1S,4R)-4-(6-chloropurin-9-yl)-4-methylcyclopent-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 11233552 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(1S,4R)-4-(6-chloropurin-9-yl)-4-methylcyclopent-2-en-1-yl] benzoate |
| SMILES | C[C@]1(n2cnc3c(Cl)ncnc32)C=C[C@@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H15ClN4O2/c1-18(23-11-22-14-15(19)20-10-21-16(14)23)8-7-13(9-18)25-17(24)12-5-3-2-4-6-12/h2-8,10-11,13H,9H2,1H3/t13-,18+/m1/s1 |
| InChIKey | OJFLIUBKRMRRAC-ACJLOTCBSA-N |
| XLogP | 3.38 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|