C24H23ClN4O6 — CID 174023996
[(3S,4S,6R)-7,8-diacetyloxy-6-(6-chloropurin-9-yl)spiro[3.4]octan-3-yl] benzoate (PubChem CID 174023996) has the molecular formula C24H23ClN4O6 and a molecular weight of 498.92 g/mol. Its IUPAC name is [(3S,4S,6R)-7,8-diacetyloxy-6-(6-chloropurin-9-yl)spiro[3.4]octan-3-yl] benzoate.
| Compound Name | [(3S,4S,6R)-7,8-diacetyloxy-6-(6-chloropurin-9-yl)spiro[3.4]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 174023996 |
| Molecular Formula | C24H23ClN4O6 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [(3S,4S,6R)-7,8-diacetyloxy-6-(6-chloropurin-9-yl)spiro[3.4]octan-3-yl] benzoate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@@]2(CC[C@@H]2OC(=O)c2ccccc2)C[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C24H23ClN4O6/c1-13(30)33-19-16(29-12-28-18-21(25)26-11-27-22(18)29)10-24(20(19)34-14(2)31)9-8-17(24)35-23(32)15-6-4-3-5-7-15/h3-7,11-12,16-17,19-20H,8-10H2,1-2H3/t16-,17+,19?,20?,24+/m1/s1 |
| InChIKey | KDTZPUFIHYUSIM-UMIQMUJZSA-N |
| XLogP | 3.29 |
| TPSA | 122.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|