C44H74O6S2Si — CID 11239770
(2R,3S,4R,6R)-3-(methoxymethoxy)-6-methyl-1-[2-[(2S,4R)-4-methyl-5-tri(propan-2-yl)silyloxypentan-2-yl]-1,3-dithian-2-yl]-4,8-bis(phenylmethoxy)octan-2-ol (PubChem CID 11239770) has the molecular formula C44H74O6S2Si and a molecular weight of 791.29 g/mol. Its IUPAC name is (2R,3S,4R,6R)-3-(methoxymethoxy)-6-methyl-1-[2-[(2S,4R)-4-methyl-5-tri(propan-2-yl)silyloxypentan-2-yl]-1,3-dithian-2-yl]-4,8-bis(phenylmethoxy)octan-2-ol.
| Compound Name | (2R,3S,4R,6R)-3-(methoxymethoxy)-6-methyl-1-[2-[(2S,4R)-4-methyl-5-tri(propan-2-yl)silyloxypentan-2-yl]-1,3-dithian-2-yl]-4,8-bis(phenylmethoxy)octan-2-ol |
|---|---|
| PubChem CID | 11239770 |
| Molecular Formula | C44H74O6S2Si |
| Molecular Weight | 791.29 g/mol |
| Exact Mass | 790.47 |
| IUPAC Name | (2R,3S,4R,6R)-3-(methoxymethoxy)-6-methyl-1-[2-[(2S,4R)-4-methyl-5-tri(propan-2-yl)silyloxypentan-2-yl]-1,3-dithian-2-yl]-4,8-bis(phenylmethoxy)octan-2-ol |
| SMILES | COCO[C@@H]([C@H](O)CC1([C@@H](C)C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)SCCCS1)[C@@H](C[C@H](C)CCOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C44H74O6S2Si/c1-33(2)53(34(3)4,35(5)6)50-29-37(8)26-38(9)44(51-24-17-25-52-44)28-41(45)43(49-32-46-10)42(48-31-40-20-15-12-16-21-40)27-36(7)22-23-47-30-39-18-13-11-14-19-39/h11-16,18-21,33-38,41-43,45H,17,22-32H2,1-10H3/t36-,37-,38+,41-,42-,43+/m1/s1 |
| InChIKey | GGNGTNCNTNKZHR-LGDUGRFASA-N |
| XLogP | 11.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.29 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|