C16H17FN4 — CID 11243086
1-(2-fluorophenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 11243086) has the molecular formula C16H17FN4 and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(2-fluorophenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 11243086 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2-fluorophenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | C=CCN/C(=N\Cc1cccnc1)Nc1ccccc1F |
| InChI | InChI=1S/C16H17FN4/c1-2-9-19-16(20-12-13-6-5-10-18-11-13)21-15-8-4-3-7-14(15)17/h2-8,10-11H,1,9,12H2,(H2,19,20,21) |
| InChIKey | LSNLRNYXXPYPEP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|