C22H14ClN3O3S2 — CID 11248356
(5E)-4-(4-chlorophenyl)-5-(1,3-dioxo-1-thiophen-2-ylpropan-2-ylidene)-N-phenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11248356) has the molecular formula C22H14ClN3O3S2 and a molecular weight of 467.96 g/mol. Its IUPAC name is (5E)-4-(4-chlorophenyl)-5-(1,3-dioxo-1-thiophen-2-ylpropan-2-ylidene)-N-phenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | (5E)-4-(4-chlorophenyl)-5-(1,3-dioxo-1-thiophen-2-ylpropan-2-ylidene)-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11248356 |
| Molecular Formula | C22H14ClN3O3S2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (5E)-4-(4-chlorophenyl)-5-(1,3-dioxo-1-thiophen-2-ylpropan-2-ylidene)-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C/C(C(=O)c1cccs1)=C1\SC(C(=O)Nc2ccccc2)=NN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14ClN3O3S2/c23-14-8-10-16(11-9-14)26-22(17(13-27)19(28)18-7-4-12-30-18)31-21(25-26)20(29)24-15-5-2-1-3-6-15/h1-13H,(H,24,29)/b22-17+ |
| InChIKey | SOGMULOBEISSPT-OQKWZONESA-N |
| XLogP | 5.20 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|