C12H9F2NO3 — CID 11253793
8,9-difluoro-5-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione (PubChem CID 11253793) has the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. Its IUPAC name is 8,9-difluoro-5-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione.
| Compound Name | 8,9-difluoro-5-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 11253793 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 8,9-difluoro-5-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
| SMILES | CC1Cc2cc(F)c(F)cc2C2OC(=O)C(=O)N12 |
| InChI | InChI=1S/C12H9F2NO3/c1-5-2-6-3-8(13)9(14)4-7(6)11-15(5)10(16)12(17)18-11/h3-5,11H,2H2,1H3 |
| InChIKey | QONWXOIUYJCZNK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|