About 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide
5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide (PubChem CID 11256086) has the molecular formula C12H11Cl3N4O
and a molecular weight of 333.61 g/mol. Its IUPAC name is 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide |
| PubChem CID | 11256086 |
| Molecular Formula | C12H11Cl3N4O |
| Molecular Weight | 333.61 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide |
| SMILES | CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(N)=O |
| InChI | InChI=1S/C12H11Cl3N4O/c1-2-8-9(12(17)20)11(16)19(18-8)10-6(14)3-5(13)4-7(10)15/h3-4H,2,16H2,1H3,(H2,17,20) |
| InChIKey | ICARZNPMUNEDAI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The IUPAC name of 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide (CID 11256086) is 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The canonical SMILES for 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide is CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(N)=O.
What is the InChIKey of 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The InChIKey is ICARZNPMUNEDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl3N4O/c1-2-8-9(12(17)20)11(16)19(18-8)10-6(14)3-5(13)4-7(10)15/h3-4H,2,16H2,1H3,(H2,17,20).
What are the key properties of 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide has a molecular weight of 333.61 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-ethyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide is sourced from PubChem (CID 11256086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).