C21H29NO5 — CID 11257360
[(1R,2S,4S,5R)-5-amino-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-2-hydroxy-2-methylcyclohexyl] benzoate (PubChem CID 11257360) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(1R,2S,4S,5R)-5-amino-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-2-hydroxy-2-methylcyclohexyl] benzoate.
| Compound Name | [(1R,2S,4S,5R)-5-amino-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-2-hydroxy-2-methylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 11257360 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [(1R,2S,4S,5R)-5-amino-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-2-hydroxy-2-methylcyclohexyl] benzoate |
| SMILES | C=C[C@]1(N)C[C@@H](OC(=O)c2ccccc2)[C@@](C)(O)C[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H29NO5/c1-5-21(22)12-17(26-18(23)14-9-7-6-8-10-14)20(4,24)11-15(21)16-13-25-19(2,3)27-16/h5-10,15-17,24H,1,11-13,22H2,2-4H3/t15-,16-,17-,20+,21+/m1/s1 |
| InChIKey | OPIKEWNVHNRCDX-QEXBRPHWSA-N |
| XLogP | 2.41 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|