C35H64O8Si2 — CID 11262392
prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11262392) has the molecular formula C35H64O8Si2 and a molecular weight of 669.06 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11262392 |
| Molecular Formula | C35H64O8Si2 |
| Molecular Weight | 669.06 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=CCOC(=O)C[C@H]1C[C@H](OC(C)=O)C[C@@]2(C[C@@](C)(O[Si](CC)(CC)CC)C[C@H](CC(=C)[C@@H](C)CO[Si](CC)(CC)CC)O2)O1 |
| InChI | InChI=1S/C35H64O8Si2/c1-12-19-38-33(37)22-30-21-31(40-29(10)36)24-35(41-30)26-34(11,43-45(16-5,17-6)18-7)23-32(42-35)20-27(8)28(9)25-39-44(13-2,14-3)15-4/h12,28,30-32H,1,8,13-26H2,2-7,9-11H3/t28-,30+,31-,32-,34-,35+/m0/s1 |
| InChIKey | PMDGTRNCXVIWBM-WGWYWTJFSA-N |
| XLogP | 8.48 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.06 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|