C10H13F2N3 — CID 112676026
3,5-difluoro-N-piperidin-1-ylpyridin-2-amine (PubChem CID 112676026) has the molecular formula C10H13F2N3 and a molecular weight of 213.23 g/mol. Its IUPAC name is 3,5-difluoro-N-piperidin-1-ylpyridin-2-amine.
| Compound Name | 3,5-difluoro-N-piperidin-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 112676026 |
| Molecular Formula | C10H13F2N3 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3,5-difluoro-N-piperidin-1-ylpyridin-2-amine |
| SMILES | Fc1cnc(NN2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C10H13F2N3/c11-8-6-9(12)10(13-7-8)14-15-4-2-1-3-5-15/h6-7H,1-5H2,(H,13,14) |
| InChIKey | XWFMZJLSLDNASC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |