C8H15N5O — CID 112681519
6-(3-methoxy-2-methylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681519) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 6-(3-methoxy-2-methylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-methoxy-2-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681519 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 6-(3-methoxy-2-methylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCC(C)Cc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5O/c1-5(4-14-2)3-6-11-7(9)13-8(10)12-6/h5H,3-4H2,1-2H3,(H4,9,10,11,12,13) |
| InChIKey | CMVYMMYBUYHZFJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |