C13H22N10O2 — CID 141091596
6-[2-[1-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 141091596) has the molecular formula C13H22N10O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is 6-[2-[1-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[1-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141091596 |
| Molecular Formula | C13H22N10O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 6-[2-[1-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(OCCc1nc(N)nc(N)n1)OCCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H22N10O2/c1-2-9(24-5-3-7-18-10(14)22-11(15)19-7)25-6-4-8-20-12(16)23-13(17)21-8/h9H,2-6H2,1H3,(H4,14,15,18,19,22)(H4,16,17,20,21,23) |
| InChIKey | BWKVFAAUMPSQCG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|