C15H29N5O4 — CID 150268397
6-[2-[2-[2-(2-methoxypropoxy)propoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 150268397) has the molecular formula C15H29N5O4 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-[2-[2-[2-(2-methoxypropoxy)propoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[2-[2-(2-methoxypropoxy)propoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 150268397 |
| Molecular Formula | C15H29N5O4 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 6-[2-[2-[2-(2-methoxypropoxy)propoxy]propoxy]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COC(C)COC(C)COC(C)COCCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C15H29N5O4/c1-10(21-4)8-23-12(3)9-24-11(2)7-22-6-5-13-18-14(16)20-15(17)19-13/h10-12H,5-9H2,1-4H3,(H4,16,17,18,19,20) |
| InChIKey | GDAPEAFDPHUUGW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|