C8H16N6O2 — CID 21183458
2-N-methoxy-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine (PubChem CID 21183458) has the molecular formula C8H16N6O2 and a molecular weight of 228.26 g/mol. Its IUPAC name is 2-N-methoxy-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-methoxy-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21183458 |
| Molecular Formula | C8H16N6O2 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-N-methoxy-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CON(OCC(C)C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C8H16N6O2/c1-5(2)4-16-14(15-3)8-12-6(9)11-7(10)13-8/h5H,4H2,1-3H3,(H4,9,10,11,12,13) |
| InChIKey | VZSHYNMIACZWJA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|