C7H11N11 — CID 144607170
2-N-(4,6-diamino-1,3,5-triazin-2-yl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 144607170) has the molecular formula C7H11N11 and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-N-(4,6-diamino-1,3,5-triazin-2-yl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4,6-diamino-1,3,5-triazin-2-yl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 144607170 |
| Molecular Formula | C7H11N11 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-N-(4,6-diamino-1,3,5-triazin-2-yl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(c1nc(N)nc(N)n1)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H11N11/c1-18(6-14-2(8)12-3(9)15-6)7-16-4(10)13-5(11)17-7/h1H3,(H4,8,9,12,14,15)(H4,10,11,13,16,17) |
| InChIKey | XXVXSAZMFOIASV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |