C5H10N6O2 — CID 159467216
[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]methanediol (PubChem CID 159467216) has the molecular formula C5H10N6O2 and a molecular weight of 186.18 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]methanediol.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]methanediol |
|---|---|
| PubChem CID | 159467216 |
| Molecular Formula | C5H10N6O2 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]methanediol |
| SMILES | CN(c1nc(N)nc(N)n1)C(O)O |
| InChI | InChI=1S/C5H10N6O2/c1-11(5(12)13)4-9-2(6)8-3(7)10-4/h5,12-13H,1H3,(H4,6,7,8,9,10) |
| InChIKey | LVIMYEUZGOAWRG-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|