C4H8N6O3 — CID 54375896
N-[4-amino-6-(dihydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine (PubChem CID 54375896) has the molecular formula C4H8N6O3 and a molecular weight of 188.15 g/mol. Its IUPAC name is N-[4-amino-6-(dihydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine.
| Compound Name | N-[4-amino-6-(dihydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 54375896 |
| Molecular Formula | C4H8N6O3 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | N-[4-amino-6-(dihydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine |
| SMILES | CN(O)c1nc(N)nc(N(O)O)n1 |
| InChI | InChI=1S/C4H8N6O3/c1-9(11)3-6-2(5)7-4(8-3)10(12)13/h11-13H,1H3,(H2,5,6,7,8) |
| InChIKey | UWLSCFMLCFOANZ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|