C9H18N6O2 — CID 70477811
2-N-[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 70477811) has the molecular formula C9H18N6O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-N-[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70477811 |
| Molecular Formula | C9H18N6O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-N-[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COC(Nc1nc(N)nc(N)n1)OCC(C)C |
| InChI | InChI=1S/C9H18N6O2/c1-5(2)4-17-9(16-3)15-8-13-6(10)12-7(11)14-8/h5,9H,4H2,1-3H3,(H5,10,11,12,13,14,15) |
| InChIKey | LRDQXPKGMOCTAM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|