C10H20N6O2 — CID 142654905
4-N-methoxy-2-N,4-N-dimethyl-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine (PubChem CID 142654905) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-N-methoxy-2-N,4-N-dimethyl-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-methoxy-2-N,4-N-dimethyl-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 142654905 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-N-methoxy-2-N,4-N-dimethyl-2-N-(2-methylpropoxy)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CON(C)c1nc(N)nc(N(C)OCC(C)C)n1 |
| InChI | InChI=1S/C10H20N6O2/c1-7(2)6-18-16(4)10-13-8(11)12-9(14-10)15(3)17-5/h7H,6H2,1-5H3,(H2,11,12,13,14) |
| InChIKey | NQGZZJQEXFFLQE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|