C5H10N6O2 — CID 21279630
formaldehyde;2-N-methoxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 21279630) has the molecular formula C5H10N6O2 and a molecular weight of 186.18 g/mol. Its IUPAC name is formaldehyde;2-N-methoxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | formaldehyde;2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21279630 |
| Molecular Formula | C5H10N6O2 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | formaldehyde;2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=O.CONc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H8N6O.CH2O/c1-11-10-4-8-2(5)7-3(6)9-4;1-2/h1H3,(H5,5,6,7,8,9,10);1H2 |
| InChIKey | RWFVJROHALFIJI-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|