C4H6N6O — CID 20638897
N-(4,6-diamino-1,3,5-triazin-2-yl)formamide (PubChem CID 20638897) has the molecular formula C4H6N6O and a molecular weight of 156.13 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)formamide.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)formamide |
|---|---|
| PubChem CID | 20638897 |
| Molecular Formula | C4H6N6O |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)formamide |
| SMILES | Nc1nc(N)nc(N[14CH]=O)n1 |
| InChI | InChI=1S/C4H6N6O/c5-2-8-3(6)10-4(9-2)7-1-11/h1H,(H5,5,6,7,8,9,10,11)/i1+2 |
| InChIKey | BPISYIZLDVUTAP-NJFSPNSNSA-N |
| XLogP | -1.40 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|