C15H28N12O6 — CID 19095110
2-N-[2-[[4,6-bis(dimethoxyamino)-1,3,5-triazin-2-yl]-methoxyamino]ethyl]-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 19095110) has the molecular formula C15H28N12O6 and a molecular weight of 472.47 g/mol. Its IUPAC name is 2-N-[2-[[4,6-bis(dimethoxyamino)-1,3,5-triazin-2-yl]-methoxyamino]ethyl]-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[[4,6-bis(dimethoxyamino)-1,3,5-triazin-2-yl]-methoxyamino]ethyl]-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19095110 |
| Molecular Formula | C15H28N12O6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-N-[2-[[4,6-bis(dimethoxyamino)-1,3,5-triazin-2-yl]-methoxyamino]ethyl]-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N)nc(N(CCN(OC)c2nc(N(OC)OC)nc(N(OC)OC)n2)OC)n1 |
| InChI | InChI=1S/C15H28N12O6/c1-17-11-18-10(16)19-12(20-11)24(28-2)8-9-25(29-3)13-21-14(26(30-4)31-5)23-15(22-13)27(32-6)33-7/h8-9H2,1-7H3,(H3,16,17,18,19,20) |
| InChIKey | CGZJHTRYMCZISU-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 183.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|