C22H38Si2 — CID 11268354
(4,5-dimethylidene-8-triethylsilylocta-1,7-diynyl)-triethylsilane (PubChem CID 11268354) has the molecular formula C22H38Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is (4,5-dimethylidene-8-triethylsilylocta-1,7-diynyl)-triethylsilane.
| Compound Name | (4,5-dimethylidene-8-triethylsilylocta-1,7-diynyl)-triethylsilane |
|---|---|
| PubChem CID | 11268354 |
| Molecular Formula | C22H38Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (4,5-dimethylidene-8-triethylsilylocta-1,7-diynyl)-triethylsilane |
| SMILES | C=C(CC#C[Si](CC)(CC)CC)C(=C)CC#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H38Si2/c1-9-23(10-2,11-3)19-15-17-21(7)22(8)18-16-20-24(12-4,13-5)14-6/h7-14,17-18H2,1-6H3 |
| InChIKey | VCKZKCPMRMAMBT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|