C10H15N3O2 — CID 112713700
4-methyl-2-(4-methylpiperazin-1-yl)-1,3-oxazole-5-carbaldehyde (PubChem CID 112713700) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-oxazole-5-carbaldehyde.
| Compound Name | 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 112713700 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-oxazole-5-carbaldehyde |
| SMILES | Cc1nc(N2CCN(C)CC2)oc1C=O |
| InChI | InChI=1S/C10H15N3O2/c1-8-9(7-14)15-10(11-8)13-5-3-12(2)4-6-13/h7H,3-6H2,1-2H3 |
| InChIKey | RTYXFDOJRZKFGX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|