C28H44N4O3Si — CID 11272246
1-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(5-hexoxyindol-1-yl)butan-2-yl]imidazole-4-carboxamide (PubChem CID 11272246) has the molecular formula C28H44N4O3Si and a molecular weight of 512.77 g/mol. Its IUPAC name is 1-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(5-hexoxyindol-1-yl)butan-2-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(5-hexoxyindol-1-yl)butan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11272246 |
| Molecular Formula | C28H44N4O3Si |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | 1-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(5-hexoxyindol-1-yl)butan-2-yl]imidazole-4-carboxamide |
| SMILES | CCCCCCOc1ccc2c(ccn2CC[C@H](CO[Si](C)(C)C(C)(C)C)n2cnc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C28H44N4O3Si/c1-7-8-9-10-17-34-24-11-12-26-22(18-24)13-15-31(26)16-14-23(20-35-36(5,6)28(2,3)4)32-19-25(27(29)33)30-21-32/h11-13,15,18-19,21,23H,7-10,14,16-17,20H2,1-6H3,(H2,29,33)/t23-/m1/s1 |
| InChIKey | WJMYJWIZVVWWKS-HSZRJFAPSA-N |
| XLogP | 6.55 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|