C16H25NO3S — CID 112723761
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 112723761) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 112723761 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)CCN1CCSC1=O)C2 |
| InChI | InChI=1S/C16H25NO3S/c1-15(2)11-4-6-16(15,3)12(10-11)20-13(18)5-7-17-8-9-21-14(17)19/h11-12H,4-10H2,1-3H3 |
| InChIKey | GQRVKUALKBGDNS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|