About (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride (PubChem CID 153408941) has the molecular formula C18H32ClNO2
and a molecular weight of 329.91 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride |
| PubChem CID | 153408941 |
| Molecular Formula | C18H32ClNO2 |
| Molecular Weight | 329.91 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)CCN1CCCCC1)C2.Cl |
| InChI | InChI=1S/C18H31NO2.ClH/c1-17(2)14-7-9-18(17,3)15(13-14)21-16(20)8-12-19-10-5-4-6-11-19;/h14-15H,4-13H2,1-3H3;1H |
| InChIKey | XPTSIMRWHCGMRT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.91 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride?
The IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride (CID 153408941) is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride.
What is the SMILES notation for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride?
The canonical SMILES for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride is CC1(C)C2CCC1(C)C(OC(=O)CCN1CCCCC1)C2.Cl.
What is the InChIKey of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride?
The InChIKey is XPTSIMRWHCGMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2.ClH/c1-17(2)14-7-9-18(17,3)15(13-14)21-16(20)8-12-19-10-5-4-6-11-19;/h14-15H,4-13H2,1-3H3;1H.
What are the key properties of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride?
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride has a molecular weight of 329.91 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-piperidin-1-ylpropanoate;hydrochloride is sourced from PubChem (CID 153408941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).