C14H15ClN2S — CID 112740978
4-chloro-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3-methylaniline (PubChem CID 112740978) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is 4-chloro-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3-methylaniline.
| Compound Name | 4-chloro-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3-methylaniline |
|---|---|
| PubChem CID | 112740978 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-chloro-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3-methylaniline |
| SMILES | Cc1cc(C)nc(Sc2c(N)ccc(Cl)c2C)c1 |
| InChI | InChI=1S/C14H15ClN2S/c1-8-6-9(2)17-13(7-8)18-14-10(3)11(15)4-5-12(14)16/h4-7H,16H2,1-3H3 |
| InChIKey | MSOXWKPSSUAJJE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|