C23H24N2O4S — CID 112770286
ethyl 2-[[2-[3-(hydroxymethyl)anilino]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 112770286) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(hydroxymethyl)anilino]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(hydroxymethyl)anilino]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 112770286 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | ethyl 2-[[2-[3-(hydroxymethyl)anilino]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CNc1cccc(CO)c1 |
| InChI | InChI=1S/C23H24N2O4S/c1-3-29-23(28)21-19(17-9-7-15(2)8-10-17)14-30-22(21)25-20(27)12-24-18-6-4-5-16(11-18)13-26/h4-11,14,24,26H,3,12-13H2,1-2H3,(H,25,27) |
| InChIKey | FPWAMVMKZVCRGG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|