C18H20OS2 — CID 11278527
(Z)-3-methyl-1,2-bis(phenylsulfanyl)pent-1-en-3-ol (PubChem CID 11278527) has the molecular formula C18H20OS2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (Z)-3-methyl-1,2-bis(phenylsulfanyl)pent-1-en-3-ol.
| Compound Name | (Z)-3-methyl-1,2-bis(phenylsulfanyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 11278527 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (Z)-3-methyl-1,2-bis(phenylsulfanyl)pent-1-en-3-ol |
| SMILES | CCC(C)(O)/C(=C/Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C18H20OS2/c1-3-18(2,19)17(21-16-12-8-5-9-13-16)14-20-15-10-6-4-7-11-15/h4-14,19H,3H2,1-2H3/b17-14- |
| InChIKey | XCLYSXMWZORICA-VKAVYKQESA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |