C32H40CoN2O4 — CID 11284567
3-[[[(1S,2S)-2-[(2-acetyl-3-oxobut-1-enyl)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]amino]methylidene]pentane-2,4-dione;cobalt (PubChem CID 11284567) has the molecular formula C32H40CoN2O4 and a molecular weight of 575.62 g/mol. Its IUPAC name is 3-[[[(1S,2S)-2-[(2-acetyl-3-oxobut-1-enyl)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]amino]methylidene]pentane-2,4-dione;cobalt.
| Compound Name | 3-[[[(1S,2S)-2-[(2-acetyl-3-oxobut-1-enyl)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]amino]methylidene]pentane-2,4-dione;cobalt |
|---|---|
| PubChem CID | 11284567 |
| Molecular Formula | C32H40CoN2O4 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 3-[[[(1S,2S)-2-[(2-acetyl-3-oxobut-1-enyl)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]amino]methylidene]pentane-2,4-dione;cobalt |
| SMILES | CC(=O)C(=CN[C@@H](c1c(C)cc(C)cc1C)[C@@H](NC=C(C(C)=O)C(C)=O)c1c(C)cc(C)cc1C)C(C)=O.[Co] |
| InChI | InChI=1S/C32H40N2O4.Co/c1-17-11-19(3)29(20(4)12-17)31(33-15-27(23(7)35)24(8)36)32(34-16-28(25(9)37)26(10)38)30-21(5)13-18(2)14-22(30)6;/h11-16,31-34H,1-10H3;/t31-,32-;/m0./s1 |
| InChIKey | WDSKJOXWWBKMGO-UEMXOEKYSA-N |
| XLogP | 5.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|