C34H64O3Si2 — CID 11284605
tert-butyl-dimethyl-[(4R,8R,9S)-8-methyl-6-methylidene-10-phenylmethoxy-9-tri(propan-2-yl)silyloxydecan-4-yl]oxysilane (PubChem CID 11284605) has the molecular formula C34H64O3Si2 and a molecular weight of 577.06 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R,8R,9S)-8-methyl-6-methylidene-10-phenylmethoxy-9-tri(propan-2-yl)silyloxydecan-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4R,8R,9S)-8-methyl-6-methylidene-10-phenylmethoxy-9-tri(propan-2-yl)silyloxydecan-4-yl]oxysilane |
|---|---|
| PubChem CID | 11284605 |
| Molecular Formula | C34H64O3Si2 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | tert-butyl-dimethyl-[(4R,8R,9S)-8-methyl-6-methylidene-10-phenylmethoxy-9-tri(propan-2-yl)silyloxydecan-4-yl]oxysilane |
| SMILES | C=C(C[C@@H](CCC)O[Si](C)(C)C(C)(C)C)C[C@@H](C)[C@@H](COCc1ccccc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H64O3Si2/c1-15-19-32(36-38(13,14)34(10,11)12)23-29(8)22-30(9)33(25-35-24-31-20-17-16-18-21-31)37-39(26(2)3,27(4)5)28(6)7/h16-18,20-21,26-28,30,32-33H,8,15,19,22-25H2,1-7,9-14H3/t30-,32-,33-/m1/s1 |
| InChIKey | QYHFPAACWIDAFB-JORIVFIJSA-N |
| XLogP | 10.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|