C17H23NO3 — CID 11289244
(2R,3aR,4S)-4-(oxan-2-yloxy)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole (PubChem CID 11289244) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (2R,3aR,4S)-4-(oxan-2-yloxy)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole.
| Compound Name | (2R,3aR,4S)-4-(oxan-2-yloxy)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole |
|---|---|
| PubChem CID | 11289244 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2R,3aR,4S)-4-(oxan-2-yloxy)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole |
| SMILES | c1ccc([C@H]2C[C@@H]3[C@@H](OC4CCCCO4)CCN3O2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-6-13(7-3-1)16-12-14-15(9-10-18(14)21-16)20-17-8-4-5-11-19-17/h1-3,6-7,14-17H,4-5,8-12H2/t14-,15+,16-,17?/m1/s1 |
| InChIKey | QAFMBCDKNDULHO-LVYZTWJOSA-N |
| XLogP | 3.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |