C20H24N3O2+ — CID 11290671
(Z,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-1-hydroxy-1-methoxybut-1-ene-2-diazonium (PubChem CID 11290671) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is (Z,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-1-hydroxy-1-methoxybut-1-ene-2-diazonium.
| Compound Name | (Z,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-1-hydroxy-1-methoxybut-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11290671 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (Z,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-1-hydroxy-1-methoxybut-1-ene-2-diazonium |
| SMILES | CO/C(O)=C(\[N+]#N)[C@H](C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-15(18-12-8-5-9-13-18)23(14-17-10-6-4-7-11-17)16(2)19(22-21)20(24)25-3/h4-13,15-16H,14H2,1-3H3/p+1/b20-19-/t15-,16-/m0/s1 |
| InChIKey | UXQPMOBPHZNTHC-SFJAUFLASA-O |
| XLogP | 4.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|