C19H31BrN2O4Si — CID 11294107
5-bromo-1-[(1S,4R)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione (PubChem CID 11294107) has the molecular formula C19H31BrN2O4Si and a molecular weight of 459.46 g/mol. Its IUPAC name is 5-bromo-1-[(1S,4R)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(1S,4R)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11294107 |
| Molecular Formula | C19H31BrN2O4Si |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 5-bromo-1-[(1S,4R)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](n2cc(Br)c(=O)[nH]c2=O)C=C1CO |
| InChI | InChI=1S/C19H31BrN2O4Si/c1-12(2)19(3,4)27(5,6)26-11-14-8-15(7-13(14)10-23)22-9-16(20)17(24)21-18(22)25/h7,9,12,14-15,23H,8,10-11H2,1-6H3,(H,21,24,25)/t14-,15+/m0/s1 |
| InChIKey | ZMJHXKGNKHDHJJ-LSDHHAIUSA-N |
| XLogP | 3.44 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|