C23H36N2O5Si — CID 10182296
ethyl (E)-3-[(3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopenten-1-yl]prop-2-enoate (PubChem CID 10182296) has the molecular formula C23H36N2O5Si and a molecular weight of 448.64 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopenten-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopenten-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10182296 |
| Molecular Formula | C23H36N2O5Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | ethyl (E)-3-[(3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopenten-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=C[C@H](n2ccc(=O)[nH]c2=O)C[C@@H]1CO[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C23H36N2O5Si/c1-8-29-21(27)10-9-17-13-19(25-12-11-20(26)24-22(25)28)14-18(17)15-30-31(6,7)23(4,5)16(2)3/h9-13,16,18-19H,8,14-15H2,1-7H3,(H,24,26,28)/b10-9+/t18-,19+/m1/s1 |
| InChIKey | AQDZUPNJEVKLLA-COQIJWMOSA-N |
| XLogP | 3.80 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|