C19H30N2O4Si — CID 10045229
(3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopentene-1-carbaldehyde (PubChem CID 10045229) has the molecular formula C19H30N2O4Si and a molecular weight of 378.55 g/mol. Its IUPAC name is (3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopentene-1-carbaldehyde.
| Compound Name | (3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 10045229 |
| Molecular Formula | C19H30N2O4Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (3R,5S)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-(2,4-dioxopyrimidin-1-yl)cyclopentene-1-carbaldehyde |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC[C@H]1C[C@@H](n2ccc(=O)[nH]c2=O)C=C1C=O |
| InChI | InChI=1S/C19H30N2O4Si/c1-13(2)19(3,4)26(5,6)25-12-15-10-16(9-14(15)11-22)21-8-7-17(23)20-18(21)24/h7-9,11,13,15-16H,10,12H2,1-6H3,(H,20,23,24)/t15-,16+/m1/s1 |
| InChIKey | QDLQZULPDQEGAV-CVEARBPZSA-N |
| XLogP | 2.88 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|